C15H12Cl2F3N3 — CID 163487133
2-chloro-N'-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-6-methylbenzenecarboximidamide (PubChem CID 163487133) has the molecular formula C15H12Cl2F3N3 and a molecular weight of 362.18 g/mol. Its IUPAC name is 2-chloro-N'-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-6-methylbenzenecarboximidamide.
| Compound Name | 2-chloro-N'-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-6-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 163487133 |
| Molecular Formula | C15H12Cl2F3N3 |
| Molecular Weight | 362.18 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 2-chloro-N'-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]-6-methylbenzenecarboximidamide |
| SMILES | Cc1cccc(Cl)c1/C(N)=N/Cc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C15H12Cl2F3N3/c1-8-3-2-4-10(16)13(8)14(21)23-7-12-11(17)5-9(6-22-12)15(18,19)20/h2-6H,7H2,1H3,(H2,21,23) |
| InChIKey | CJMXXMVIHLWTIN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.18 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|