C10H11ClF3N2O2+ — CID 7097279
[(2R)-3-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1-methoxy-1-oxopropan-2-yl]azanium (PubChem CID 7097279) has the molecular formula C10H11ClF3N2O2+ and a molecular weight of 283.66 g/mol. Its IUPAC name is [(2R)-3-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1-methoxy-1-oxopropan-2-yl]azanium.
| Compound Name | [(2R)-3-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1-methoxy-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 7097279 |
| Molecular Formula | C10H11ClF3N2O2+ |
| Molecular Weight | 283.66 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | [(2R)-3-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1-methoxy-1-oxopropan-2-yl]azanium |
| SMILES | COC(=O)[C@H]([NH3+])Cc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H10ClF3N2O2/c1-18-9(17)7(15)3-8-6(11)2-5(4-16-8)10(12,13)14/h2,4,7H,3,15H2,1H3/p+1/t7-/m1/s1 |
| InChIKey | MIWSOSOLEGQQOR-SSDOTTSWSA-O |
| XLogP | 1.08 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.66 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |