C10H9ClF3NO4 — CID 171864714
methyl 3-[2-chloro-5-(trifluoromethyl)-3-pyridinyl]-2,3-dihydroxypropanoate (PubChem CID 171864714) has the molecular formula C10H9ClF3NO4 and a molecular weight of 299.63 g/mol. Its IUPAC name is methyl 3-[2-chloro-5-(trifluoromethyl)-3-pyridinyl]-2,3-dihydroxypropanoate.
| Compound Name | methyl 3-[2-chloro-5-(trifluoromethyl)-3-pyridinyl]-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171864714 |
| Molecular Formula | C10H9ClF3NO4 |
| Molecular Weight | 299.63 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | methyl 3-[2-chloro-5-(trifluoromethyl)-3-pyridinyl]-2,3-dihydroxypropanoate |
| SMILES | COC(=O)C(O)C(O)c1cc(C(F)(F)F)cnc1Cl |
| InChI | InChI=1S/C10H9ClF3NO4/c1-19-9(18)7(17)6(16)5-2-4(10(12,13)14)3-15-8(5)11/h2-3,6-7,16-17H,1H3 |
| InChIKey | MGZXQCQSRIIHTO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.63 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|