C10H12ClF3N2O2 — CID 171858601
1-[2-chloro-5-(trifluoromethyl)-3-pyridinyl]-3-(methylamino)propane-1,2-diol (PubChem CID 171858601) has the molecular formula C10H12ClF3N2O2 and a molecular weight of 284.67 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)-3-pyridinyl]-3-(methylamino)propane-1,2-diol.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)-3-pyridinyl]-3-(methylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 171858601 |
| Molecular Formula | C10H12ClF3N2O2 |
| Molecular Weight | 284.67 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)-3-pyridinyl]-3-(methylamino)propane-1,2-diol |
| SMILES | CNCC(O)C(O)c1cc(C(F)(F)F)cnc1Cl |
| InChI | InChI=1S/C10H12ClF3N2O2/c1-15-4-7(17)8(18)6-2-5(10(12,13)14)3-16-9(6)11/h2-3,7-8,15,17-18H,4H2,1H3 |
| InChIKey | DVJBNJBOYHXPRE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.67 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|