C10H12Cl3NO2 — CID 171859145
3-(methylamino)-1-(2,4,6-trichlorophenyl)propane-1,2-diol (PubChem CID 171859145) has the molecular formula C10H12Cl3NO2 and a molecular weight of 284.57 g/mol. Its IUPAC name is 3-(methylamino)-1-(2,4,6-trichlorophenyl)propane-1,2-diol.
| Compound Name | 3-(methylamino)-1-(2,4,6-trichlorophenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 171859145 |
| Molecular Formula | C10H12Cl3NO2 |
| Molecular Weight | 284.57 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | 3-(methylamino)-1-(2,4,6-trichlorophenyl)propane-1,2-diol |
| SMILES | CNCC(O)C(O)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl3NO2/c1-14-4-8(15)10(16)9-6(12)2-5(11)3-7(9)13/h2-3,8,10,14-16H,4H2,1H3 |
| InChIKey | HEQHNCWWCBBJNC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.57 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |