C13H18ClNO3 — CID 170829889
N-[3-(4-chloro-2,6-dimethylphenyl)-2,3-dihydroxypropyl]acetamide (PubChem CID 170829889) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is N-[3-(4-chloro-2,6-dimethylphenyl)-2,3-dihydroxypropyl]acetamide.
| Compound Name | N-[3-(4-chloro-2,6-dimethylphenyl)-2,3-dihydroxypropyl]acetamide |
|---|---|
| PubChem CID | 170829889 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-[3-(4-chloro-2,6-dimethylphenyl)-2,3-dihydroxypropyl]acetamide |
| SMILES | CC(=O)NCC(O)C(O)c1c(C)cc(Cl)cc1C |
| InChI | InChI=1S/C13H18ClNO3/c1-7-4-10(14)5-8(2)12(7)13(18)11(17)6-15-9(3)16/h4-5,11,13,17-18H,6H2,1-3H3,(H,15,16) |
| InChIKey | YUIGPGANEPHIRL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |