C13H17ClO3S — CID 170821765
S-[3-(4-chloro-2,6-dimethylphenyl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170821765) has the molecular formula C13H17ClO3S and a molecular weight of 288.80 g/mol. Its IUPAC name is S-[3-(4-chloro-2,6-dimethylphenyl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(4-chloro-2,6-dimethylphenyl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170821765 |
| Molecular Formula | C13H17ClO3S |
| Molecular Weight | 288.80 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | S-[3-(4-chloro-2,6-dimethylphenyl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1c(C)cc(Cl)cc1C |
| InChI | InChI=1S/C13H17ClO3S/c1-7-4-10(14)5-8(2)12(7)13(17)11(16)6-18-9(3)15/h4-5,11,13,16-17H,6H2,1-3H3 |
| InChIKey | DKQBVIZCEWINJF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.80 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|