C14H15NO5S — CID 170822766
S-[2,3-dihydroxy-3-(5-methyl-2,3-dioxo-1H-indol-4-yl)propyl] ethanethioate (PubChem CID 170822766) has the molecular formula C14H15NO5S and a molecular weight of 309.34 g/mol. Its IUPAC name is S-[2,3-dihydroxy-3-(5-methyl-2,3-dioxo-1H-indol-4-yl)propyl] ethanethioate.
| Compound Name | S-[2,3-dihydroxy-3-(5-methyl-2,3-dioxo-1H-indol-4-yl)propyl] ethanethioate |
|---|---|
| PubChem CID | 170822766 |
| Molecular Formula | C14H15NO5S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | S-[2,3-dihydroxy-3-(5-methyl-2,3-dioxo-1H-indol-4-yl)propyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1c(C)ccc2c1C(=O)C(=O)N2 |
| InChI | InChI=1S/C14H15NO5S/c1-6-3-4-8-11(13(19)14(20)15-8)10(6)12(18)9(17)5-21-7(2)16/h3-4,9,12,17-18H,5H2,1-2H3,(H,15,19,20) |
| InChIKey | NMQHNTOPVQCFEB-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|