C16H18O3S — CID 170822663
S-[2,3-dihydroxy-3-(2-methylnaphthalen-1-yl)propyl] ethanethioate (PubChem CID 170822663) has the molecular formula C16H18O3S and a molecular weight of 290.38 g/mol. Its IUPAC name is S-[2,3-dihydroxy-3-(2-methylnaphthalen-1-yl)propyl] ethanethioate.
| Compound Name | S-[2,3-dihydroxy-3-(2-methylnaphthalen-1-yl)propyl] ethanethioate |
|---|---|
| PubChem CID | 170822663 |
| Molecular Formula | C16H18O3S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | S-[2,3-dihydroxy-3-(2-methylnaphthalen-1-yl)propyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1c(C)ccc2ccccc12 |
| InChI | InChI=1S/C16H18O3S/c1-10-7-8-12-5-3-4-6-13(12)15(10)16(19)14(18)9-20-11(2)17/h3-8,14,16,18-19H,9H2,1-2H3 |
| InChIKey | PJJIPPOYCFQPJO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|