C17H22O — CID 81432516
2,3-dimethyl-1-(2-methylnaphthalen-1-yl)butan-1-ol (PubChem CID 81432516) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is 2,3-dimethyl-1-(2-methylnaphthalen-1-yl)butan-1-ol.
| Compound Name | 2,3-dimethyl-1-(2-methylnaphthalen-1-yl)butan-1-ol |
|---|---|
| PubChem CID | 81432516 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 2,3-dimethyl-1-(2-methylnaphthalen-1-yl)butan-1-ol |
| SMILES | Cc1ccc2ccccc2c1C(O)C(C)C(C)C |
| InChI | InChI=1S/C17H22O/c1-11(2)13(4)17(18)16-12(3)9-10-14-7-5-6-8-15(14)16/h5-11,13,17-18H,1-4H3 |
| InChIKey | WIYKKGQFANPRGA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |