C13H11F3O — CID 14810052
(1R)-2,2,2-trifluoro-1-(2-methylnaphthalen-1-yl)ethanol (PubChem CID 14810052) has the molecular formula C13H11F3O and a molecular weight of 240.22 g/mol. Its IUPAC name is (1R)-2,2,2-trifluoro-1-(2-methylnaphthalen-1-yl)ethanol.
| Compound Name | (1R)-2,2,2-trifluoro-1-(2-methylnaphthalen-1-yl)ethanol |
|---|---|
| PubChem CID | 14810052 |
| Molecular Formula | C13H11F3O |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | (1R)-2,2,2-trifluoro-1-(2-methylnaphthalen-1-yl)ethanol |
| SMILES | Cc1ccc2ccccc2c1[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C13H11F3O/c1-8-6-7-9-4-2-3-5-10(9)11(8)12(17)13(14,15)16/h2-7,12,17H,1H3/t12-/m1/s1 |
| InChIKey | BFUXWTYQATZUOI-GFCCVEGCSA-N |
| XLogP | 3.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |