C15H15F4N — CID 81432025
2,2,3,3-tetrafluoro-N-methyl-1-(2-methylnaphthalen-1-yl)propan-1-amine (PubChem CID 81432025) has the molecular formula C15H15F4N and a molecular weight of 285.28 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-methyl-1-(2-methylnaphthalen-1-yl)propan-1-amine.
| Compound Name | 2,2,3,3-tetrafluoro-N-methyl-1-(2-methylnaphthalen-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 81432025 |
| Molecular Formula | C15H15F4N |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-methyl-1-(2-methylnaphthalen-1-yl)propan-1-amine |
| SMILES | CNC(c1c(C)ccc2ccccc12)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H15F4N/c1-9-7-8-10-5-3-4-6-11(10)12(9)13(20-2)15(18,19)14(16)17/h3-8,13-14,20H,1-2H3 |
| InChIKey | RBIMHVDVMFVGFZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|