C20H27N — CID 81429025
2-cyclohexyl-N-methyl-1-(2-methylnaphthalen-1-yl)ethanamine (PubChem CID 81429025) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is 2-cyclohexyl-N-methyl-1-(2-methylnaphthalen-1-yl)ethanamine.
| Compound Name | 2-cyclohexyl-N-methyl-1-(2-methylnaphthalen-1-yl)ethanamine |
|---|---|
| PubChem CID | 81429025 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 2-cyclohexyl-N-methyl-1-(2-methylnaphthalen-1-yl)ethanamine |
| SMILES | CNC(CC1CCCCC1)c1c(C)ccc2ccccc12 |
| InChI | InChI=1S/C20H27N/c1-15-12-13-17-10-6-7-11-18(17)20(15)19(21-2)14-16-8-4-3-5-9-16/h6-7,10-13,16,19,21H,3-5,8-9,14H2,1-2H3 |
| InChIKey | MYHYLAWVOODVAO-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |