C14H11F5O — CID 81431477
2,2,3,3,3-pentafluoro-1-(2-methylnaphthalen-1-yl)propan-1-ol (PubChem CID 81431477) has the molecular formula C14H11F5O and a molecular weight of 290.23 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(2-methylnaphthalen-1-yl)propan-1-ol.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(2-methylnaphthalen-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 81431477 |
| Molecular Formula | C14H11F5O |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(2-methylnaphthalen-1-yl)propan-1-ol |
| SMILES | Cc1ccc2ccccc2c1C(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H11F5O/c1-8-6-7-9-4-2-3-5-10(9)11(8)12(20)13(15,16)14(17,18)19/h2-7,12,20H,1H3 |
| InChIKey | AEKLFRUENANXAI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|