C14H15NO3S — CID 170822150
S-(2,3-dihydroxy-3-quinolin-2-ylpropyl) ethanethioate (PubChem CID 170822150) has the molecular formula C14H15NO3S and a molecular weight of 277.35 g/mol. Its IUPAC name is S-(2,3-dihydroxy-3-quinolin-2-ylpropyl) ethanethioate.
| Compound Name | S-(2,3-dihydroxy-3-quinolin-2-ylpropyl) ethanethioate |
|---|---|
| PubChem CID | 170822150 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | S-(2,3-dihydroxy-3-quinolin-2-ylpropyl) ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C14H15NO3S/c1-9(16)19-8-13(17)14(18)12-7-6-10-4-2-3-5-11(10)15-12/h2-7,13-14,17-18H,8H2,1H3 |
| InChIKey | SYSWCMPUCADRKM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|