C11H15NO4S — CID 170821715
S-[2,3-dihydroxy-3-[5-(hydroxymethyl)-2-pyridinyl]propyl] ethanethioate (PubChem CID 170821715) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is S-[2,3-dihydroxy-3-[5-(hydroxymethyl)-2-pyridinyl]propyl] ethanethioate.
| Compound Name | S-[2,3-dihydroxy-3-[5-(hydroxymethyl)-2-pyridinyl]propyl] ethanethioate |
|---|---|
| PubChem CID | 170821715 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | S-[2,3-dihydroxy-3-[5-(hydroxymethyl)-2-pyridinyl]propyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1ccc(CO)cn1 |
| InChI | InChI=1S/C11H15NO4S/c1-7(14)17-6-10(15)11(16)9-3-2-8(5-13)4-12-9/h2-4,10-11,13,15-16H,5-6H2,1H3 |
| InChIKey | YWYADHWOAHSNDD-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|