C8H12N2O3S — CID 170821319
S-[2,3-dihydroxy-3-(1H-imidazol-2-yl)propyl] ethanethioate (PubChem CID 170821319) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is S-[2,3-dihydroxy-3-(1H-imidazol-2-yl)propyl] ethanethioate.
| Compound Name | S-[2,3-dihydroxy-3-(1H-imidazol-2-yl)propyl] ethanethioate |
|---|---|
| PubChem CID | 170821319 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | S-[2,3-dihydroxy-3-(1H-imidazol-2-yl)propyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1ncc[nH]1 |
| InChI | InChI=1S/C8H12N2O3S/c1-5(11)14-4-6(12)7(13)8-9-2-3-10-8/h2-3,6-7,12-13H,4H2,1H3,(H,9,10) |
| InChIKey | IMSICUMXTFSQFJ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|