C11H12N2O3S — CID 170821588
S-[3-(2-cyano-3-pyridinyl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170821588) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is S-[3-(2-cyano-3-pyridinyl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(2-cyano-3-pyridinyl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170821588 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | S-[3-(2-cyano-3-pyridinyl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1cccnc1C#N |
| InChI | InChI=1S/C11H12N2O3S/c1-7(14)17-6-10(15)11(16)8-3-2-4-13-9(8)5-12/h2-4,10-11,15-16H,6H2,1H3 |
| InChIKey | GSPQBTUVLUICKV-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|