C12H14N2O3S — CID 170821914
S-[3-(3-amino-2-cyanophenyl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170821914) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is S-[3-(3-amino-2-cyanophenyl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(3-amino-2-cyanophenyl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170821914 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | S-[3-(3-amino-2-cyanophenyl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1cccc(N)c1C#N |
| InChI | InChI=1S/C12H14N2O3S/c1-7(15)18-6-11(16)12(17)8-3-2-4-10(14)9(8)5-13/h2-4,11-12,16-17H,6,14H2,1H3 |
| InChIKey | LUBDERNOIMSMTC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|