C12H15ClO4S — CID 170823162
S-[3-(2-chloro-3-methoxyphenyl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170823162) has the molecular formula C12H15ClO4S and a molecular weight of 290.77 g/mol. Its IUPAC name is S-[3-(2-chloro-3-methoxyphenyl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(2-chloro-3-methoxyphenyl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170823162 |
| Molecular Formula | C12H15ClO4S |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | S-[3-(2-chloro-3-methoxyphenyl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | COc1cccc(C(O)C(O)CSC(C)=O)c1Cl |
| InChI | InChI=1S/C12H15ClO4S/c1-7(14)18-6-9(15)12(16)8-4-3-5-10(17-2)11(8)13/h3-5,9,12,15-16H,6H2,1-2H3 |
| InChIKey | YWRBRJBTVVKEHG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|