C12H15NO5S — CID 170822406
2-(3-acetylsulfanyl-1,2-dihydroxypropyl)-6-aminobenzoic acid (PubChem CID 170822406) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is 2-(3-acetylsulfanyl-1,2-dihydroxypropyl)-6-aminobenzoic acid.
| Compound Name | 2-(3-acetylsulfanyl-1,2-dihydroxypropyl)-6-aminobenzoic acid |
|---|---|
| PubChem CID | 170822406 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-(3-acetylsulfanyl-1,2-dihydroxypropyl)-6-aminobenzoic acid |
| SMILES | CC(=O)SCC(O)C(O)c1cccc(N)c1C(=O)O |
| InChI | InChI=1S/C12H15NO5S/c1-6(14)19-5-9(15)11(16)7-3-2-4-8(13)10(7)12(17)18/h2-4,9,11,15-16H,5,13H2,1H3,(H,17,18) |
| InChIKey | ZSWDMMCMORXQBR-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|