C10H13NO4S — CID 170820348
2-amino-6-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid (PubChem CID 170820348) has the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. Its IUPAC name is 2-amino-6-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid.
| Compound Name | 2-amino-6-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid |
|---|---|
| PubChem CID | 170820348 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2-amino-6-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid |
| SMILES | Nc1cccc(C(O)C(O)CS)c1C(=O)O |
| InChI | InChI=1S/C10H13NO4S/c11-6-3-1-2-5(8(6)10(14)15)9(13)7(12)4-16/h1-3,7,9,12-13,16H,4,11H2,(H,14,15) |
| InChIKey | QOXYQRBOMKLCQS-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|