2-amino-6-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid

C10H13NO4S — CID 170820348

IUPAC2-amino-6-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid
SMILESNc1cccc(C(O)C(O)CS)c1C(=O)O
InChIInChI=1S/C10H13NO4S/c11-6-3-1-2-5(8(6)10(14)15)9(13)7(12)4-16/h1-3,7,9,12-13,16H,4,11H2,(H,14,15)
InChIKeyQOXYQRBOMKLCQS-UHFFFAOYSA-N
MW243.28 g/mol
LogP0.29
Rot. Bonds4

About 2-amino-6-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid

2-amino-6-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid (PubChem CID 170820348) has the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. Its IUPAC name is 2-amino-6-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid.

Molecular Properties

Compound Name2-amino-6-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid
PubChem CID170820348
Molecular FormulaC10H13NO4S
Molecular Weight243.28 g/mol
Exact Mass243.06
IUPAC Name2-amino-6-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid
SMILESNc1cccc(C(O)C(O)CS)c1C(=O)O
InChIInChI=1S/C10H13NO4S/c11-6-3-1-2-5(8(6)10(14)15)9(13)7(12)4-16/h1-3,7,9,12-13,16H,4,11H2,(H,14,15)
InChIKeyQOXYQRBOMKLCQS-UHFFFAOYSA-N
XLogP0.29
TPSA103.78 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.28
LogP ≤ 50.29
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze 2-amino-6-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-6-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid?
The IUPAC name of 2-amino-6-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid (CID 170820348) is 2-amino-6-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid.
What is the SMILES notation for 2-amino-6-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid?
The canonical SMILES for 2-amino-6-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid is Nc1cccc(C(O)C(O)CS)c1C(=O)O.
What is the InChIKey of 2-amino-6-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid?
The InChIKey is QOXYQRBOMKLCQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4S/c11-6-3-1-2-5(8(6)10(14)15)9(13)7(12)4-16/h1-3,7,9,12-13,16H,4,11H2,(H,14,15).
What are the key properties of 2-amino-6-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid?
2-amino-6-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid has a molecular weight of 243.28 g/mol, XLogP of 0.29, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-(1,2-dihydroxy-3-sulfanylpropyl)benzoic acid is sourced from PubChem (CID 170820348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).