C10H15NO2S — CID 170819603
1-[2-(aminomethyl)phenyl]-3-sulfanylpropane-1,2-diol (PubChem CID 170819603) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is 1-[2-(aminomethyl)phenyl]-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-[2-(aminomethyl)phenyl]-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170819603 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 1-[2-(aminomethyl)phenyl]-3-sulfanylpropane-1,2-diol |
| SMILES | NCc1ccccc1C(O)C(O)CS |
| InChI | InChI=1S/C10H15NO2S/c11-5-7-3-1-2-4-8(7)10(13)9(12)6-14/h1-4,9-10,12-14H,5-6,11H2 |
| InChIKey | CBRBSNUKLGVHOI-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|