C10H13FO3S — CID 170819789
1-[2-fluoro-3-(hydroxymethyl)phenyl]-3-sulfanylpropane-1,2-diol (PubChem CID 170819789) has the molecular formula C10H13FO3S and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-[2-fluoro-3-(hydroxymethyl)phenyl]-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-[2-fluoro-3-(hydroxymethyl)phenyl]-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170819789 |
| Molecular Formula | C10H13FO3S |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 1-[2-fluoro-3-(hydroxymethyl)phenyl]-3-sulfanylpropane-1,2-diol |
| SMILES | OCc1cccc(C(O)C(O)CS)c1F |
| InChI | InChI=1S/C10H13FO3S/c11-9-6(4-12)2-1-3-7(9)10(14)8(13)5-15/h1-3,8,10,12-15H,4-5H2 |
| InChIKey | XNTZEUJDZOLJDO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|