C15H24O2S — CID 170820724
1-[2,6-di(propan-2-yl)phenyl]-3-sulfanylpropane-1,2-diol (PubChem CID 170820724) has the molecular formula C15H24O2S and a molecular weight of 268.42 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170820724 |
| Molecular Formula | C15H24O2S |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-sulfanylpropane-1,2-diol |
| SMILES | CC(C)c1cccc(C(C)C)c1C(O)C(O)CS |
| InChI | InChI=1S/C15H24O2S/c1-9(2)11-6-5-7-12(10(3)4)14(11)15(17)13(16)8-18/h5-7,9-10,13,15-18H,8H2,1-4H3 |
| InChIKey | GDODYUVEULLUQZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|