C8H13NO2S — CID 170821220
1-(1-methylpyrrol-2-yl)-3-sulfanylpropane-1,2-diol (PubChem CID 170821220) has the molecular formula C8H13NO2S and a molecular weight of 187.26 g/mol. Its IUPAC name is 1-(1-methylpyrrol-2-yl)-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-(1-methylpyrrol-2-yl)-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170821220 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 1-(1-methylpyrrol-2-yl)-3-sulfanylpropane-1,2-diol |
| SMILES | Cn1cccc1C(O)C(O)CS |
| InChI | InChI=1S/C8H13NO2S/c1-9-4-2-3-6(9)8(11)7(10)5-12/h2-4,7-8,10-12H,5H2,1H3 |
| InChIKey | IHHZCSWLMKLFDJ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|