C12H14N2O2 — CID 171976356
2-hydroxy-1,2-bis(1-methylpyrrol-2-yl)ethanone (PubChem CID 171976356) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-hydroxy-1,2-bis(1-methylpyrrol-2-yl)ethanone.
| Compound Name | 2-hydroxy-1,2-bis(1-methylpyrrol-2-yl)ethanone |
|---|---|
| PubChem CID | 171976356 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-hydroxy-1,2-bis(1-methylpyrrol-2-yl)ethanone |
| SMILES | Cn1cccc1C(=O)C(O)c1cccn1C |
| InChI | InChI=1S/C12H14N2O2/c1-13-7-3-5-9(13)11(15)12(16)10-6-4-8-14(10)2/h3-8,11,15H,1-2H3 |
| InChIKey | NCPVVSWSMINVGH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 47.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |