C11H13NO4 — CID 98169172
methyl (3R)-3-methyl-4-(1-methylpyrrol-2-yl)-2,4-dioxobutanoate (PubChem CID 98169172) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is methyl (3R)-3-methyl-4-(1-methylpyrrol-2-yl)-2,4-dioxobutanoate.
| Compound Name | methyl (3R)-3-methyl-4-(1-methylpyrrol-2-yl)-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 98169172 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | methyl (3R)-3-methyl-4-(1-methylpyrrol-2-yl)-2,4-dioxobutanoate |
| SMILES | COC(=O)C(=O)[C@H](C)C(=O)c1cccn1C |
| InChI | InChI=1S/C11H13NO4/c1-7(10(14)11(15)16-3)9(13)8-5-4-6-12(8)2/h4-7H,1-3H3/t7-/m1/s1 |
| InChIKey | ARRNKXRJGPCRFF-SSDOTTSWSA-N |
| XLogP | 0.59 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|