C8H11N3O3 — CID 112550883
N-(2-amino-2-oxoethoxy)-1-methylpyrrole-2-carboxamide (PubChem CID 112550883) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is N-(2-amino-2-oxoethoxy)-1-methylpyrrole-2-carboxamide.
| Compound Name | N-(2-amino-2-oxoethoxy)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 112550883 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | N-(2-amino-2-oxoethoxy)-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cccc1C(=O)NOCC(N)=O |
| InChI | InChI=1S/C8H11N3O3/c1-11-4-2-3-6(11)8(13)10-14-5-7(9)12/h2-4H,5H2,1H3,(H2,9,12)(H,10,13) |
| InChIKey | RYVJOLZHCSQXDM-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|