C17H17N3O5 — CID 7889613
[2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 2-benzamidoacetate (PubChem CID 7889613) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 2-benzamidoacetate.
| Compound Name | [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 2-benzamidoacetate |
|---|---|
| PubChem CID | 7889613 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 2-benzamidoacetate |
| SMILES | Cn1cccc1C(=O)NC(=O)COC(=O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H17N3O5/c1-20-9-5-8-13(20)17(24)19-14(21)11-25-15(22)10-18-16(23)12-6-3-2-4-7-12/h2-9H,10-11H2,1H3,(H,18,23)(H,19,21,24) |
| InChIKey | UZMKXSNZZCKQGN-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |