C11H20N2O — CID 143101069
ethane;1-methyl-N-propylpyrrole-2-carboxamide (PubChem CID 143101069) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is ethane;1-methyl-N-propylpyrrole-2-carboxamide.
| Compound Name | ethane;1-methyl-N-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 143101069 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | ethane;1-methyl-N-propylpyrrole-2-carboxamide |
| SMILES | CC.CCCNC(=O)c1cccn1C |
| InChI | InChI=1S/C9H14N2O.C2H6/c1-3-6-10-9(12)8-5-4-7-11(8)2;1-2/h4-5,7H,3,6H2,1-2H3,(H,10,12);1-2H3 |
| InChIKey | XMXYYHZDKGXJQZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |