C12H18N2O2 — CID 115699871
1-methyl-N-[2-(2-methylprop-2-enoxy)ethyl]pyrrole-2-carboxamide (PubChem CID 115699871) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 1-methyl-N-[2-(2-methylprop-2-enoxy)ethyl]pyrrole-2-carboxamide.
| Compound Name | 1-methyl-N-[2-(2-methylprop-2-enoxy)ethyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 115699871 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1-methyl-N-[2-(2-methylprop-2-enoxy)ethyl]pyrrole-2-carboxamide |
| SMILES | C=C(C)COCCNC(=O)c1cccn1C |
| InChI | InChI=1S/C12H18N2O2/c1-10(2)9-16-8-6-13-12(15)11-5-4-7-14(11)3/h4-5,7H,1,6,8-9H2,2-3H3,(H,13,15) |
| InChIKey | NHBOSLOJIUSYOQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|