C11H15N3O2 — CID 115769401
N-[2-(2-methylprop-2-enoxy)ethyl]pyridazine-4-carboxamide (PubChem CID 115769401) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is N-[2-(2-methylprop-2-enoxy)ethyl]pyridazine-4-carboxamide.
| Compound Name | N-[2-(2-methylprop-2-enoxy)ethyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 115769401 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N-[2-(2-methylprop-2-enoxy)ethyl]pyridazine-4-carboxamide |
| SMILES | C=C(C)COCCNC(=O)c1ccnnc1 |
| InChI | InChI=1S/C11H15N3O2/c1-9(2)8-16-6-5-12-11(15)10-3-4-13-14-7-10/h3-4,7H,1,5-6,8H2,2H3,(H,12,15) |
| InChIKey | GELJTWMNXDFFDH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|