C14H17N5O2 — CID 114469543
N-[2-(2-methylprop-2-enoxy)ethyl]-3-(2H-tetrazol-5-yl)benzamide (PubChem CID 114469543) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is N-[2-(2-methylprop-2-enoxy)ethyl]-3-(2H-tetrazol-5-yl)benzamide.
| Compound Name | N-[2-(2-methylprop-2-enoxy)ethyl]-3-(2H-tetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 114469543 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N-[2-(2-methylprop-2-enoxy)ethyl]-3-(2H-tetrazol-5-yl)benzamide |
| SMILES | C=C(C)COCCNC(=O)c1cccc(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C14H17N5O2/c1-10(2)9-21-7-6-15-14(20)12-5-3-4-11(8-12)13-16-18-19-17-13/h3-5,8H,1,6-7,9H2,2H3,(H,15,20)(H,16,17,18,19) |
| InChIKey | UDBHTXQCXJRSNI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|