C30H30N4O4 — CID 164624876
3-pyridin-3-yl-N-[2-[2-[2-[(3-pyridin-3-ylbenzoyl)amino]ethoxy]ethoxy]ethyl]benzamide (PubChem CID 164624876) has the molecular formula C30H30N4O4 and a molecular weight of 510.59 g/mol. Its IUPAC name is 3-pyridin-3-yl-N-[2-[2-[2-[(3-pyridin-3-ylbenzoyl)amino]ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | 3-pyridin-3-yl-N-[2-[2-[2-[(3-pyridin-3-ylbenzoyl)amino]ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 164624876 |
| Molecular Formula | C30H30N4O4 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 3-pyridin-3-yl-N-[2-[2-[2-[(3-pyridin-3-ylbenzoyl)amino]ethoxy]ethoxy]ethyl]benzamide |
| SMILES | O=C(NCCOCCOCCNC(=O)c1cccc(-c2cccnc2)c1)c1cccc(-c2cccnc2)c1 |
| InChI | InChI=1S/C30H30N4O4/c35-29(25-7-1-5-23(19-25)27-9-3-11-31-21-27)33-13-15-37-17-18-38-16-14-34-30(36)26-8-2-6-24(20-26)28-10-4-12-32-22-28/h1-12,19-22H,13-18H2,(H,33,35)(H,34,36) |
| InChIKey | KBJVRMBHBBJTSO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|