C18H22N2O — CID 21361607
N-(3,3-dimethylbutyl)-3-pyridin-3-ylbenzamide (PubChem CID 21361607) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-3-pyridin-3-ylbenzamide.
| Compound Name | N-(3,3-dimethylbutyl)-3-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 21361607 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N-(3,3-dimethylbutyl)-3-pyridin-3-ylbenzamide |
| SMILES | CC(C)(C)CCNC(=O)c1cccc(-c2cccnc2)c1 |
| InChI | InChI=1S/C18H22N2O/c1-18(2,3)9-11-20-17(21)15-7-4-6-14(12-15)16-8-5-10-19-13-16/h4-8,10,12-13H,9,11H2,1-3H3,(H,20,21) |
| InChIKey | NUBDFGMNROMYCJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |