C12H17BrN2O — CID 103754460
2-bromo-N-(3,3-dimethylbutyl)pyridine-4-carboxamide (PubChem CID 103754460) has the molecular formula C12H17BrN2O and a molecular weight of 285.19 g/mol. Its IUPAC name is 2-bromo-N-(3,3-dimethylbutyl)pyridine-4-carboxamide.
| Compound Name | 2-bromo-N-(3,3-dimethylbutyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 103754460 |
| Molecular Formula | C12H17BrN2O |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 2-bromo-N-(3,3-dimethylbutyl)pyridine-4-carboxamide |
| SMILES | CC(C)(C)CCNC(=O)c1ccnc(Br)c1 |
| InChI | InChI=1S/C12H17BrN2O/c1-12(2,3)5-7-15-11(16)9-4-6-14-10(13)8-9/h4,6,8H,5,7H2,1-3H3,(H,15,16) |
| InChIKey | HKSGIFHYYHYNFU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|