C9H11BrN4O2 — CID 103755430
2-bromo-N-[2-(carbamoylamino)ethyl]pyridine-4-carboxamide (PubChem CID 103755430) has the molecular formula C9H11BrN4O2 and a molecular weight of 287.12 g/mol. Its IUPAC name is 2-bromo-N-[2-(carbamoylamino)ethyl]pyridine-4-carboxamide.
| Compound Name | 2-bromo-N-[2-(carbamoylamino)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 103755430 |
| Molecular Formula | C9H11BrN4O2 |
| Molecular Weight | 287.12 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 2-bromo-N-[2-(carbamoylamino)ethyl]pyridine-4-carboxamide |
| SMILES | NC(=O)NCCNC(=O)c1ccnc(Br)c1 |
| InChI | InChI=1S/C9H11BrN4O2/c10-7-5-6(1-2-12-7)8(15)13-3-4-14-9(11)16/h1-2,5H,3-4H2,(H,13,15)(H3,11,14,16) |
| InChIKey | OJPXYQJYCBJWND-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.12 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|