C13H11BrN4O2 — CID 103752137
2-bromo-N-[4-(carbamoylamino)phenyl]pyridine-4-carboxamide (PubChem CID 103752137) has the molecular formula C13H11BrN4O2 and a molecular weight of 335.16 g/mol. Its IUPAC name is 2-bromo-N-[4-(carbamoylamino)phenyl]pyridine-4-carboxamide.
| Compound Name | 2-bromo-N-[4-(carbamoylamino)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 103752137 |
| Molecular Formula | C13H11BrN4O2 |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 2-bromo-N-[4-(carbamoylamino)phenyl]pyridine-4-carboxamide |
| SMILES | NC(=O)Nc1ccc(NC(=O)c2ccnc(Br)c2)cc1 |
| InChI | InChI=1S/C13H11BrN4O2/c14-11-7-8(5-6-16-11)12(19)17-9-1-3-10(4-2-9)18-13(15)20/h1-7H,(H,17,19)(H3,15,18,20) |
| InChIKey | WPNUZKKDWJRWBM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|