C14H12BrN3O3 — CID 103752263
N-[4-(2-amino-2-oxoethoxy)phenyl]-2-bromopyridine-4-carboxamide (PubChem CID 103752263) has the molecular formula C14H12BrN3O3 and a molecular weight of 350.17 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethoxy)phenyl]-2-bromopyridine-4-carboxamide.
| Compound Name | N-[4-(2-amino-2-oxoethoxy)phenyl]-2-bromopyridine-4-carboxamide |
|---|---|
| PubChem CID | 103752263 |
| Molecular Formula | C14H12BrN3O3 |
| Molecular Weight | 350.17 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | N-[4-(2-amino-2-oxoethoxy)phenyl]-2-bromopyridine-4-carboxamide |
| SMILES | NC(=O)COc1ccc(NC(=O)c2ccnc(Br)c2)cc1 |
| InChI | InChI=1S/C14H12BrN3O3/c15-12-7-9(5-6-17-12)14(20)18-10-1-3-11(4-2-10)21-8-13(16)19/h1-7H,8H2,(H2,16,19)(H,18,20) |
| InChIKey | QZLVFZJIYKOIFX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.17 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|