C14H12BrN3O2 — CID 103753891
2-bromo-N-[4-(methylcarbamoyl)phenyl]pyridine-4-carboxamide (PubChem CID 103753891) has the molecular formula C14H12BrN3O2 and a molecular weight of 334.17 g/mol. Its IUPAC name is 2-bromo-N-[4-(methylcarbamoyl)phenyl]pyridine-4-carboxamide.
| Compound Name | 2-bromo-N-[4-(methylcarbamoyl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 103753891 |
| Molecular Formula | C14H12BrN3O2 |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 2-bromo-N-[4-(methylcarbamoyl)phenyl]pyridine-4-carboxamide |
| SMILES | CNC(=O)c1ccc(NC(=O)c2ccnc(Br)c2)cc1 |
| InChI | InChI=1S/C14H12BrN3O2/c1-16-13(19)9-2-4-11(5-3-9)18-14(20)10-6-7-17-12(15)8-10/h2-8H,1H3,(H,16,19)(H,18,20) |
| InChIKey | FLJDYMKRDICSOJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|