C11H15BrN2O3S — CID 113255247
2-bromo-N-(2-methyl-2-methylsulfonylpropyl)pyridine-4-carboxamide (PubChem CID 113255247) has the molecular formula C11H15BrN2O3S and a molecular weight of 335.22 g/mol. Its IUPAC name is 2-bromo-N-(2-methyl-2-methylsulfonylpropyl)pyridine-4-carboxamide.
| Compound Name | 2-bromo-N-(2-methyl-2-methylsulfonylpropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 113255247 |
| Molecular Formula | C11H15BrN2O3S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 2-bromo-N-(2-methyl-2-methylsulfonylpropyl)pyridine-4-carboxamide |
| SMILES | CC(C)(CNC(=O)c1ccnc(Br)c1)S(C)(=O)=O |
| InChI | InChI=1S/C11H15BrN2O3S/c1-11(2,18(3,16)17)7-14-10(15)8-4-5-13-9(12)6-8/h4-6H,7H2,1-3H3,(H,14,15) |
| InChIKey | ZMPIYLPMXWLFRP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|