C9H14N2O3 — CID 174886318
(3-amino-2-hydroxypropyl) 1-methylpyrrole-2-carboxylate (PubChem CID 174886318) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is (3-amino-2-hydroxypropyl) 1-methylpyrrole-2-carboxylate.
| Compound Name | (3-amino-2-hydroxypropyl) 1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 174886318 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | (3-amino-2-hydroxypropyl) 1-methylpyrrole-2-carboxylate |
| SMILES | Cn1cccc1C(=O)OCC(O)CN |
| InChI | InChI=1S/C9H14N2O3/c1-11-4-2-3-8(11)9(13)14-6-7(12)5-10/h2-4,7,12H,5-6,10H2,1H3 |
| InChIKey | LHYIELRMEWDYQJ-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |