C8H14N2O2 — CID 170829352
3-amino-1-(1-methylpyrrol-2-yl)propane-1,2-diol (PubChem CID 170829352) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 3-amino-1-(1-methylpyrrol-2-yl)propane-1,2-diol.
| Compound Name | 3-amino-1-(1-methylpyrrol-2-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 170829352 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 3-amino-1-(1-methylpyrrol-2-yl)propane-1,2-diol |
| SMILES | Cn1cccc1C(O)C(O)CN |
| InChI | InChI=1S/C8H14N2O2/c1-10-4-2-3-6(10)8(12)7(11)5-9/h2-4,7-8,11-12H,5,9H2,1H3 |
| InChIKey | OAVOWSUZZXUDNW-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |