C10H19N3 — CID 171212571
(1R)-1-(1-methylpyrrol-2-yl)pentane-1,5-diamine (PubChem CID 171212571) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is (1R)-1-(1-methylpyrrol-2-yl)pentane-1,5-diamine.
| Compound Name | (1R)-1-(1-methylpyrrol-2-yl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 171212571 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | (1R)-1-(1-methylpyrrol-2-yl)pentane-1,5-diamine |
| SMILES | Cn1cccc1[C@H](N)CCCCN |
| InChI | InChI=1S/C10H19N3/c1-13-8-4-6-10(13)9(12)5-2-3-7-11/h4,6,8-9H,2-3,5,7,11-12H2,1H3/t9-/m1/s1 |
| InChIKey | NVHQKPDKPSWREJ-SECBINFHSA-N |
| XLogP | 1.15 |
| TPSA | 56.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|