About benzene;5-methylhexan-1-amine
benzene;5-methylhexan-1-amine (PubChem CID 174722076) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is benzene;5-methylhexan-1-amine.
Molecular Properties
| Compound Name | benzene;5-methylhexan-1-amine |
| PubChem CID | 174722076 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | benzene;5-methylhexan-1-amine |
| SMILES | CC(C)CCCCN.c1ccccc1 |
| InChI | InChI=1S/C7H17N.C6H6/c1-7(2)5-3-4-6-8;1-2-4-6-5-3-1/h7H,3-6,8H2,1-2H3;1-6H |
| InChIKey | DRLUFGIAIFVTJA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzene;5-methylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;5-methylhexan-1-amine?
The IUPAC name of benzene;5-methylhexan-1-amine (CID 174722076) is benzene;5-methylhexan-1-amine.
What is the SMILES notation for benzene;5-methylhexan-1-amine?
The canonical SMILES for benzene;5-methylhexan-1-amine is CC(C)CCCCN.c1ccccc1.
What is the InChIKey of benzene;5-methylhexan-1-amine?
The InChIKey is DRLUFGIAIFVTJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N.C6H6/c1-7(2)5-3-4-6-8;1-2-4-6-5-3-1/h7H,3-6,8H2,1-2H3;1-6H.
What are the key properties of benzene;5-methylhexan-1-amine?
benzene;5-methylhexan-1-amine has a molecular weight of 193.33 g/mol, XLogP of 3.46, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;5-methylhexan-1-amine is sourced from PubChem (CID 174722076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).