C15H26N2 — CID 83157179
N'-(4-methylpentyl)-N'-phenylpropane-1,3-diamine (PubChem CID 83157179) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is N'-(4-methylpentyl)-N'-phenylpropane-1,3-diamine.
| Compound Name | N'-(4-methylpentyl)-N'-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 83157179 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | N'-(4-methylpentyl)-N'-phenylpropane-1,3-diamine |
| SMILES | CC(C)CCCN(CCCN)c1ccccc1 |
| InChI | InChI=1S/C15H26N2/c1-14(2)8-6-12-17(13-7-11-16)15-9-4-3-5-10-15/h3-5,9-10,14H,6-8,11-13,16H2,1-2H3 |
| InChIKey | MTHHELWUWIMAAE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |