C14H24N2 — CID 107895596
N'-pentan-2-yl-N'-phenylpropane-1,3-diamine (PubChem CID 107895596) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N'-pentan-2-yl-N'-phenylpropane-1,3-diamine.
| Compound Name | N'-pentan-2-yl-N'-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 107895596 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N'-pentan-2-yl-N'-phenylpropane-1,3-diamine |
| SMILES | CCCC(C)N(CCCN)c1ccccc1 |
| InChI | InChI=1S/C14H24N2/c1-3-8-13(2)16(12-7-11-15)14-9-5-4-6-10-14/h4-6,9-10,13H,3,7-8,11-12,15H2,1-2H3 |
| InChIKey | FJGFGODLCTXBHH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |