C14H24N2 — CID 43136067
N'-butan-2-yl-N'-(4-methylphenyl)propane-1,3-diamine (PubChem CID 43136067) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N'-butan-2-yl-N'-(4-methylphenyl)propane-1,3-diamine.
| Compound Name | N'-butan-2-yl-N'-(4-methylphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 43136067 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N'-butan-2-yl-N'-(4-methylphenyl)propane-1,3-diamine |
| SMILES | CCC(C)N(CCCN)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H24N2/c1-4-13(3)16(11-5-10-15)14-8-6-12(2)7-9-14/h6-9,13H,4-5,10-11,15H2,1-3H3 |
| InChIKey | HTEQKBJKKXEJIZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|