C19H23Cl2N5O2 — CID 89180615
N'-butan-2-yl-N'-[4-[(2,6-dichloro-4-nitrophenyl)diazenyl]phenyl]propane-1,3-diamine (PubChem CID 89180615) has the molecular formula C19H23Cl2N5O2 and a molecular weight of 424.33 g/mol. Its IUPAC name is N'-butan-2-yl-N'-[4-[(2,6-dichloro-4-nitrophenyl)diazenyl]phenyl]propane-1,3-diamine.
| Compound Name | N'-butan-2-yl-N'-[4-[(2,6-dichloro-4-nitrophenyl)diazenyl]phenyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 89180615 |
| Molecular Formula | C19H23Cl2N5O2 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | N'-butan-2-yl-N'-[4-[(2,6-dichloro-4-nitrophenyl)diazenyl]phenyl]propane-1,3-diamine |
| SMILES | CCC(C)N(CCCN)c1ccc(/N=N/c2c(Cl)cc([N+](=O)[O-])cc2Cl)cc1 |
| InChI | InChI=1S/C19H23Cl2N5O2/c1-3-13(2)25(10-4-9-22)15-7-5-14(6-8-15)23-24-19-17(20)11-16(26(27)28)12-18(19)21/h5-8,11-13H,3-4,9-10,22H2,1-2H3/b24-23+ |
| InChIKey | WAVAYRONPDGMGF-WCWDXBQESA-N |
| XLogP | 6.27 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|